Products 3037659-64-3
CAS 3037659-64-3 is the registry number for tert-Butyl (R)-2-(4-(methoxycarbonyl)phenyl)morpholine-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (2R)-2-(4-methoxycarbonylphenyl)morpholine-4-carboxylate (CAS 3037659-64-3) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: tert-butyl (2R)-2-(4-methoxycarbonylphenyl)morpholine-4-carboxylate. InChIKey: OFPZYNFKSDUJCG-AWEZNQCLSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | tert-butyl (2R)-2-(4-methoxycarbonylphenyl)morpholine-4-carboxylate |
| InChIKey | OFPZYNFKSDUJCG-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)