Products 303770-90-3
CAS 303770-90-3 appears in our catalog under these names: 4-((3,5-Dimethylphenyl)amino)-4-oxobutanoic acid, 98%, 98%, 4-((3,5-Dimethylphenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(3,5-dimethylanilino)-4-oxobutanoic acid (CAS 303770-90-3) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-(3,5-dimethylanilino)-4-oxobutanoic acid. InChIKey: FIUYHKALQQJECD-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(3,5-dimethylanilino)-4-oxobutanoic acid |
| InChIKey | FIUYHKALQQJECD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)CCC(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
4-((3,5-Dimethylphenyl)amino)-4-oxobutanoic acid, 4-(3,5-dimethylanilino)-4-oxobutanoic acid, 4-[(3,5-dimethylphenyl)amino]-4-oxobutanoic acid, starbld0023341, CBMicro_017187, Oprea1_100395, Oprea1_368466, N-(3,5-Dimethylphenyl)succinamic acid, 3-[N-(3,5-dimethylphenyl)carbamoyl]propanoic acid, Butanoic acid, 4-[(3,5-dimethylphenyl)amino]-4-oxo-