CAS 303997-00-4 appears in our catalog under these names: 1-(2,6-Dichlorobenzyl)-1h-indole-2,3-dione, 95%, 1-(2,6-Dichlorobenzyl)indoline-2,3-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-[(2,6-dichlorophenyl)methyl]indole-2,3-dione (CAS 303997-00-4) is a chemical compound with the molecular formula C15H9Cl2NO2 and a molecular weight of 306.1 g/mol. IUPAC name: 1-[(2,6-dichlorophenyl)methyl]indole-2,3-dione. InChIKey: DGUYNCOMHJNSBV-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2NO2 |
|---|---|
| Molecular weight | 306.1 g/mol |
| IUPAC name | 1-[(2,6-dichlorophenyl)methyl]indole-2,3-dione |
| InChIKey | DGUYNCOMHJNSBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2CC3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)