CAS 87423-59-4 is the registry number for 5-Chloro-1-[(4-chlorophenyl)methyl]-2,3-dihydro-1H-indole-2,3-dione 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-chloro-1-[(4-chlorophenyl)methyl]indole-2,3-dione (CAS 87423-59-4) is a chemical compound with the molecular formula C15H9Cl2NO2 and a molecular weight of 306.1 g/mol. IUPAC name: 5-chloro-1-[(4-chlorophenyl)methyl]indole-2,3-dione. InChIKey: NWUYWKYKVCEBTP-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2NO2 |
|---|---|
| Molecular weight | 306.1 g/mol |
| IUPAC name | 5-chloro-1-[(4-chlorophenyl)methyl]indole-2,3-dione |
| InChIKey | NWUYWKYKVCEBTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C3=C(C=C(C=C3)Cl)C(=O)C2=O)Cl |
Computed by PubChem (NCBI)