Products 443289-94-9
CAS 443289-94-9 is the registry number for 2-((2,6-Dichloro-4-formylphenoxy)methyl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,6-dichloro-4-formylphenoxy)methyl]benzonitrile (CAS 443289-94-9) is a chemical compound with the molecular formula C15H9Cl2NO2 and a molecular weight of 306.1 g/mol. IUPAC name: 2-[(2,6-dichloro-4-formylphenoxy)methyl]benzonitrile. InChIKey: NNDXSMGSIKDHJS-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2NO2 |
|---|---|
| Molecular weight | 306.1 g/mol |
| IUPAC name | 2-[(2,6-dichloro-4-formylphenoxy)methyl]benzonitrile |
| InChIKey | NNDXSMGSIKDHJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=C(C=C(C=C2Cl)C=O)Cl)C#N |
Computed by PubChem (NCBI)