Products 420097-22-9
CAS 420097-22-9 is the registry number for N-(3,4-Dichlorophenyl)benzofuran-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(3,4-dichlorophenyl)-1-benzofuran-2-carboxamide (CAS 420097-22-9) is a chemical compound with the molecular formula C15H9Cl2NO2 and a molecular weight of 306.1 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-1-benzofuran-2-carboxamide. InChIKey: NEWFUOFHOLXMKW-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2NO2 |
|---|---|
| Molecular weight | 306.1 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-1-benzofuran-2-carboxamide |
| InChIKey | NEWFUOFHOLXMKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)