Products 3041044-52-1
CAS 3041044-52-1 appears in our catalog under these names: 6-hydroxy-N-(4-hydroxy-2,6-dimethylphenyl)pyridine-2-carboxamide, 6-Hydroxy-N-(4-hydroxy-2,6-dimethylphen. Offered by: Chemat, Sigma-Aldrich. Available pack sizes: 1g.
N-(4-hydroxy-2,6-dimethylphenyl)-6-oxo-1H-pyridine-2-carboxamide (CAS 3041044-52-1) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: N-(4-hydroxy-2,6-dimethylphenyl)-6-oxo-1H-pyridine-2-carboxamide. InChIKey: OMPOMWIZHFYXMV-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | N-(4-hydroxy-2,6-dimethylphenyl)-6-oxo-1H-pyridine-2-carboxamide |
| InChIKey | OMPOMWIZHFYXMV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C2=CC=CC(=O)N2)C)O |
Computed by PubChem (NCBI)