Products 30448-16-9
CAS 30448-16-9 appears in our catalog under these names: 7-Methyl-1h-indole-3-carboxylic acid, 98%, 7–Methyl–1h–indole–3–carboxylic acid, 7-Methyl-1H-indole-3-carboxylic acid 97%, 7-Methyl-1H-indole-3-carboxylic acid, 97%, 97%, 7-Methyl-1H-indole-3-carboxylic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
7-methyl-1H-indole-3-carboxylic acid (CAS 30448-16-9) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 7-methyl-1H-indole-3-carboxylic acid. InChIKey: SRYCADDCUWPWAE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 7-methyl-1H-indole-3-carboxylic acid |
| InChIKey | SRYCADDCUWPWAE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)