Products 3049446-57-0
CAS 3049446-57-0 is the registry number for CRBN ligand-63. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(5-bromo-2-methoxyphenyl)piperidine-2,6-dione (CAS 3049446-57-0) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: 3-(5-bromo-2-methoxyphenyl)piperidine-2,6-dione. InChIKey: XSLVFDZDYCOSPT-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO3 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 3-(5-bromo-2-methoxyphenyl)piperidine-2,6-dione |
| InChIKey | XSLVFDZDYCOSPT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C2CCC(=O)NC2=O |
Computed by PubChem (NCBI)