CAS 30504-49-5 appears in our catalog under these names: Azobenzene-d10, 99 atom % D, min 98% Chemical Purity, Azobenzene-d10. Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 100mg, 50mg, 1 mg.
Bis(2,3,4,5,6-pentadeuteriophenyl)diazene (CAS 30504-49-5) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 192.28 g/mol. IUPAC name: bis(2,3,4,5,6-pentadeuteriophenyl)diazene. InChIKey: DMLAVOWQYNRWNQ-LHNTUAQVSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentadeuteriophenyl)diazene |
| InChIKey | DMLAVOWQYNRWNQ-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N=NC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)