CAS 3056016-82-8 is the registry number for Ferroptosis-IN-8, 98.24%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10 mg, 25 mg, 50 mg, 5 mg.
2-amino-3-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (CAS 3056016-82-8) is a chemical compound with the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. IUPAC name: 2-amino-3-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide. InChIKey: DSEQTSAKWGVMMQ-RQZCQDPDSA-N.
| Molecular formula | C15H15N3O3 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | 2-amino-3-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| InChIKey | DSEQTSAKWGVMMQ-RQZCQDPDSA-N |
| SMILES | COC1=CC=C(C=C1)/C=N/NC(=O)C2=C(C(=CC=C2)O)N |
Computed by PubChem (NCBI)