CAS 305851-22-3 is the registry number for N-(4-methoxybenzyl)-3-nitroaniline. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(4-methoxyphenyl)methyl]-3-nitroaniline (CAS 305851-22-3) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-3-nitroaniline. InChIKey: KEAKJFQOFXVQFJ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]-3-nitroaniline |
| InChIKey | KEAKJFQOFXVQFJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)