CAS 306-98-9 appears in our catalog under these names: Perfluoro-1,2-Dimethylcyclohexane, Perfluoro-1,2-dimethylcyclohexane, ≥70%. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 1g, 2g, 5g.
1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-bis(trifluoromethyl)cyclohexane (CAS 306-98-9) is a chemical compound with the molecular formula C8F16 and a molecular weight of 400.06 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-bis(trifluoromethyl)cyclohexane. InChIKey: GHBZJUJZNRLHBI-UHFFFAOYSA-N.
| Molecular formula | C8F16 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-bis(trifluoromethyl)cyclohexane |
| InChIKey | GHBZJUJZNRLHBI-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)