CAS 335-27-3 appears in our catalog under these names: Perfluoro-1,3-dimethylcyclohexane, 95%, Perfluoro–1,3–dimethylcyclohexane, Perfluoro(1,3-dimethylcyclohexane), tech. 90% , Hexadecafluoro(1,3-dimethylcyclohexane), Hexadecafluoro(1,3-dimethylcyclohexane), >80.0%(GC). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 25g, 5g, 50g, 250g, 100g, 500g.
1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(trifluoromethyl)cyclohexane (CAS 335-27-3) is a chemical compound with the molecular formula C8F16 and a molecular weight of 400.06 g/mol. IUPAC name: 1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(trifluoromethyl)cyclohexane. InChIKey: LOQGSOTUHASIHI-UHFFFAOYSA-N.
| Molecular formula | C8F16 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(trifluoromethyl)cyclohexane |
| InChIKey | LOQGSOTUHASIHI-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)