CAS 559-14-8 is the registry number for Perfluorooctene-1, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooct-1-ene (CAS 559-14-8) is a chemical compound with the molecular formula C8F16 and a molecular weight of 400.06 g/mol. IUPAC name: 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooct-1-ene. InChIKey: YCBPKOZNGFQMPB-UHFFFAOYSA-N.
| Molecular formula | C8F16 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooct-1-ene |
| InChIKey | YCBPKOZNGFQMPB-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)