CAS 335-21-7 is the registry number for Perfluoro(Ethylcyclohexane). Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,1,2,2,2-pentafluoroethyl)cyclohexane (CAS 335-21-7) is a chemical compound with the molecular formula C8F16 and a molecular weight of 400.06 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,1,2,2,2-pentafluoroethyl)cyclohexane. InChIKey: SEEJHICDPXGSRQ-UHFFFAOYSA-N.
| Molecular formula | C8F16 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,1,2,2,2-pentafluoroethyl)cyclohexane |
| InChIKey | SEEJHICDPXGSRQ-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)