CAS 3061-93-6 appears in our catalog under these names: H-ALA-D-PHE-OH, H–Ala–D–Phe–OH. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 500mg, 1g, 5g, 2000mg, 1000mg, 5000mg.
(2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoic acid (CAS 3061-93-6) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoic acid. InChIKey: OMNVYXHOSHNURL-WCBMZHEXSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | OMNVYXHOSHNURL-WCBMZHEXSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](CC1=CC=CC=C1)C(=O)O)N |
Computed by PubChem (NCBI)