CAS 3061-94-7 is the registry number for H–D–Ala–D–Phe–OH hydrate. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoic acid (CAS 3061-94-7) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: (2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoic acid. InChIKey: OMNVYXHOSHNURL-PSASIEDQSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | OMNVYXHOSHNURL-PSASIEDQSA-N |
| SMILES | C[C@H](C(=O)N[C@H](CC1=CC=CC=C1)C(=O)O)N |
Computed by PubChem (NCBI)