CAS 717874-18-5 is the registry number for Methyl n-1,3-benzodioxol-5-yl-n-(methylsulfonyl)glycinate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]acetate (CAS 717874-18-5) is a chemical compound with the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. IUPAC name: methyl 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]acetate. InChIKey: APBFMKXLABDIGZ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | methyl 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]acetate |
| InChIKey | APBFMKXLABDIGZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CN(C1=CC2=C(C=C1)OCO2)S(=O)(=O)C |
Computed by PubChem (NCBI)