CAS 4816-82-4 appears in our catalog under these names: (S)-2-(4-Methylphenylsulfonamido)succinic acid, 95%+, 95%+, N-Tosyl-L-aspartic Acid, Tos-Asp-OH 95%. Offered by: Chemat, TRC, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 2,5g.
(2S)-2-[(4-methylphenyl)sulfonylamino]butanedioic acid (CAS 4816-82-4) is a chemical compound with the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. IUPAC name: (2S)-2-[(4-methylphenyl)sulfonylamino]butanedioic acid. InChIKey: SVCQSZKHLAERDL-VIFPVBQESA-N.
| Molecular formula | C11H13NO6S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | (2S)-2-[(4-methylphenyl)sulfonylamino]butanedioic acid |
| InChIKey | SVCQSZKHLAERDL-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)