Products 3065084-99-0
CAS 3065084-99-0 is the registry number for (R)-4-(3-Aminopyrrolidin-1-yl)benzonitrile Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[(3R)-3-aminopyrrolidin-1-yl]benzonitrile;hydrochloride (CAS 3065084-99-0) is a chemical compound with the molecular formula C11H14ClN3 and a molecular weight of 223.70 g/mol. IUPAC name: 4-[(3R)-3-aminopyrrolidin-1-yl]benzonitrile;hydrochloride. InChIKey: AKFRVBMJTLOETP-HNCPQSOCSA-N.
| Molecular formula | C11H14ClN3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 4-[(3R)-3-aminopyrrolidin-1-yl]benzonitrile;hydrochloride |
| InChIKey | AKFRVBMJTLOETP-HNCPQSOCSA-N |
| SMILES | C1CN(C[C@@H]1N)C2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)