CAS 3065251-92-2 is the registry number for CRBN ligand-183. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-2-(2,6-dioxopiperidin-3-yl)benzonitrile (CAS 3065251-92-2) is a chemical compound with the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. IUPAC name: 5-bromo-2-(2,6-dioxopiperidin-3-yl)benzonitrile. InChIKey: YTNLEPJVUWWTGH-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2 |
|---|---|
| Molecular weight | 293.12 g/mol |
| IUPAC name | 5-bromo-2-(2,6-dioxopiperidin-3-yl)benzonitrile |
| InChIKey | YTNLEPJVUWWTGH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2)Br)C#N |
Computed by PubChem (NCBI)