Products 3069895-37-7
CAS 3069895-37-7 is the registry number for 3,5-Dichloro-4-(2,6-dioxopiperidin-3-yl)benzonitrile, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)benzonitrile (CAS 3069895-37-7) is a chemical compound with the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. IUPAC name: 3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)benzonitrile. InChIKey: KFBDPISEOFMWHH-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | 3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)benzonitrile |
| InChIKey | KFBDPISEOFMWHH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2Cl)C#N)Cl |
Computed by PubChem (NCBI)