Products 3070212-13-1
CAS 3070212-13-1 is the registry number for 7-chloro-2-methoxy-1,6-naphthyridine-5-carbonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
7-chloro-2-methoxy-1,6-naphthyridine-5-carbonitrile (CAS 3070212-13-1) is a chemical compound with the molecular formula C10H6ClN3O and a molecular weight of 219.63 g/mol. IUPAC name: 7-chloro-2-methoxy-1,6-naphthyridine-5-carbonitrile. InChIKey: LPFJUSYSTITXSN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 7-chloro-2-methoxy-1,6-naphthyridine-5-carbonitrile |
| InChIKey | LPFJUSYSTITXSN-UHFFFAOYSA-N |
| SMILES | COC1=NC2=CC(=NC(=C2C=C1)C#N)Cl |
Computed by PubChem (NCBI)