CAS 1403589-25-2 appears in our catalog under these names: 6-Chloro-3h-pyrimido[4,5-b]indol-4(9h)-one, 95%, 6-Chloro-3H-pyrimido(4,5-b)indol-4(9H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-chloro-3,9-dihydropyrimido[4,5-b]indol-4-one (CAS 1403589-25-2) is a chemical compound with the molecular formula C10H6ClN3O and a molecular weight of 219.63 g/mol. IUPAC name: 6-chloro-3,9-dihydropyrimido[4,5-b]indol-4-one. InChIKey: VSFXGUSQGSIRIK-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 6-chloro-3,9-dihydropyrimido[4,5-b]indol-4-one |
| InChIKey | VSFXGUSQGSIRIK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(N2)N=CNC3=O |
Computed by PubChem (NCBI)