Products 790263-25-1
CAS 790263-25-1 appears in our catalog under these names: 2-(3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl)acetonitrile, 95%, 2-(3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetonitrile (CAS 790263-25-1) is a chemical compound with the molecular formula C10H6ClN3O and a molecular weight of 219.63 g/mol. IUPAC name: 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetonitrile. InChIKey: UYXSPNGDHZUTRL-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]acetonitrile |
| InChIKey | UYXSPNGDHZUTRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CC#N)Cl |
Computed by PubChem (NCBI)