CAS 870973-92-5 appears in our catalog under these names: 3-(5-(Chloromethyl)-1,3,4-oxadiazol-2-yl)benzonitrile, 95%, 3-(5-(Chloromethyl)-1,3,4-oxadiazol-2-yl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]benzonitrile (CAS 870973-92-5) is a chemical compound with the molecular formula C10H6ClN3O and a molecular weight of 219.63 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]benzonitrile. InChIKey: VXBGMUZLSIALKT-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]benzonitrile |
| InChIKey | VXBGMUZLSIALKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NN=C(O2)CCl)C#N |
Computed by PubChem (NCBI)