CAS 1334331-42-8 is the registry number for 8-Chloro-4H,5H-imidazo(1,5-a)quinoxalin-4-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
8-chloro-5H-imidazo[1,5-a]quinoxalin-4-one (CAS 1334331-42-8) is a chemical compound with the molecular formula C10H6ClN3O and a molecular weight of 219.63 g/mol. IUPAC name: 8-chloro-5H-imidazo[1,5-a]quinoxalin-4-one. InChIKey: RSPSBLMJISTJKJ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 8-chloro-5H-imidazo[1,5-a]quinoxalin-4-one |
| InChIKey | RSPSBLMJISTJKJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N3C=NC=C3C(=O)N2 |
Computed by PubChem (NCBI)