CAS 3073-05-0 appears in our catalog under these names: P-Quinquephenyl, 95%, P-quinquephenyl, 98%, 1,1':4',1'':4'',1''':4''',1''''–Quinquephenyl, p-Quinquephenyl, 98% , p-Quinquephenyl. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 1g, 250mg, 50mg.
1,4-bis(4-phenylphenyl)benzene (CAS 3073-05-0) is a chemical compound with the molecular formula C30H22 and a molecular weight of 382.5 g/mol. IUPAC name: 1,4-bis(4-phenylphenyl)benzene. InChIKey: OMCUOJTVNIHQTI-UHFFFAOYSA-N.
| Molecular formula | C30H22 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 1,4-bis(4-phenylphenyl)benzene |
| InChIKey | OMCUOJTVNIHQTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)