CAS 54842-92-1 is the registry number for 9,10-Bis(4-vinylphenyl)anthracene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9,10-bis(4-ethenylphenyl)anthracene (CAS 54842-92-1) is a chemical compound with the molecular formula C30H22 and a molecular weight of 382.5 g/mol. IUPAC name: 9,10-bis(4-ethenylphenyl)anthracene. InChIKey: XDKXYJQSMJUNFY-UHFFFAOYSA-N.
| Molecular formula | C30H22 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 9,10-bis(4-ethenylphenyl)anthracene |
| InChIKey | XDKXYJQSMJUNFY-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=C(C=C5)C=C |
Computed by PubChem (NCBI)