Products 3383-32-2
CAS 3383-32-2 is the registry number for 1,2,4,5-tetraphenylbenzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1,2,4,5-tetraphenylbenzene (CAS 3383-32-2) is a chemical compound with the molecular formula C30H22 and a molecular weight of 382.5 g/mol. IUPAC name: 1,2,4,5-tetraphenylbenzene. InChIKey: JTXZAAHCKALMFR-UHFFFAOYSA-N.
| Molecular formula | C30H22 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 1,2,4,5-tetraphenylbenzene |
| InChIKey | JTXZAAHCKALMFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)