CAS 58225-37-9 is the registry number for (5-Benzylidenecyclopenta-1,3-diene-1,2,3-triyl)tribenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(5E)-5-benzylidene-2,3-diphenylcyclopenta-1,3-dien-1-yl]benzene (CAS 58225-37-9) is a chemical compound with the molecular formula C30H22 and a molecular weight of 382.5 g/mol. IUPAC name: [(5E)-5-benzylidene-2,3-diphenylcyclopenta-1,3-dien-1-yl]benzene. InChIKey: DUOLVCQVQGYWKL-SZXQPVLSSA-N.
| Molecular formula | C30H22 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | [(5E)-5-benzylidene-2,3-diphenylcyclopenta-1,3-dien-1-yl]benzene |
| InChIKey | DUOLVCQVQGYWKL-SZXQPVLSSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/2\C=C(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)