CAS 307512-24-9 appears in our catalog under these names: 5-(4-Bromophenyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%, 5-(4-Bromophenyl)thieno[2,3-d]pyrimidin-4-ol, 95%, 5-(4-Bromophenyl)thieno(2,3-d)pyrimidin-4(3H)-one, 95+%, 5–(4–Bromophenyl)thieno(2,3–d)pyrimidin–4(3H)–one, 5-(4-Bromophenyl)thieno[2,3-d]pyrimidin-4(3H)-one, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
5-(4-bromophenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 307512-24-9) is a chemical compound with the molecular formula C12H7BrN2OS and a molecular weight of 307.17 g/mol. IUPAC name: 5-(4-bromophenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: MGLDBSICXJAWCJ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2OS |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | MGLDBSICXJAWCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=O)NC=N3)Br |
Computed by PubChem (NCBI)