CAS 852840-45-0 appears in our catalog under these names: 6-(4-Bromophenyl)-3H,4H-thieno(3,2-d)pyrimidin-4-one, 6-(4-Bromo-phenyl)-3H-thieno[3,2-d]pyrimidin-4-one. Offered by: Biosynth, Fluorochem. Available pack sizes: 250mg, 2,5g, 50mg, 100mg, 500mg, 1g, 2.5g.
6-(4-bromophenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 852840-45-0) is a chemical compound with the molecular formula C12H7BrN2OS and a molecular weight of 307.17 g/mol. IUPAC name: 6-(4-bromophenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: CTZPYIQFWUGOTD-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2OS |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | 6-(4-bromophenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | CTZPYIQFWUGOTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(S2)C(=O)NC=N3)Br |
Computed by PubChem (NCBI)