Products 957065-93-9
CAS 957065-93-9 is the registry number for 2-(3-bromophenyl)-5-(thiophen-2-yl)-1,3,4-oxadiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)-5-thiophen-2-yl-1,3,4-oxadiazole (CAS 957065-93-9) is a chemical compound with the molecular formula C12H7BrN2OS and a molecular weight of 307.17 g/mol. IUPAC name: 2-(3-bromophenyl)-5-thiophen-2-yl-1,3,4-oxadiazole. InChIKey: JVUJDTWUKFHVDP-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2OS |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | 2-(3-bromophenyl)-5-thiophen-2-yl-1,3,4-oxadiazole |
| InChIKey | JVUJDTWUKFHVDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=C(O2)C3=CC=CS3 |
Computed by PubChem (NCBI)