Products 330459-34-2
CAS 330459-34-2 is the registry number for 3-(4-Bromophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-(4-bromophenyl)-5-thiophen-2-yl-1,2,4-oxadiazole (CAS 330459-34-2) is a chemical compound with the molecular formula C12H7BrN2OS and a molecular weight of 307.17 g/mol. IUPAC name: 3-(4-bromophenyl)-5-thiophen-2-yl-1,2,4-oxadiazole. InChIKey: ZRPAZLXMPZUEMQ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2OS |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-thiophen-2-yl-1,2,4-oxadiazole |
| InChIKey | ZRPAZLXMPZUEMQ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=NO2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)