CAS 3077-51-8 is the registry number for H-Glu(OMe)-OH (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-5-methoxy-5-oxopentanoic acid;hydrochloride (CAS 3077-51-8) is a chemical compound with the molecular formula C6H12ClNO4 and a molecular weight of 197.62 g/mol. IUPAC name: (2S)-2-amino-5-methoxy-5-oxopentanoic acid;hydrochloride. InChIKey: NTWTYOQNGBVBFH-WCCKRBBISA-N.
| Molecular formula | C6H12ClNO4 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (2S)-2-amino-5-methoxy-5-oxopentanoic acid;hydrochloride |
| InChIKey | NTWTYOQNGBVBFH-WCCKRBBISA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)