Products 3082545-22-7
CAS 3082545-22-7 is the registry number for Methyl (E)-3-(3-amino-6-chloropyridin-2-yl)acrylate, 90%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (E)-3-(3-amino-6-chloro-2-pyridinyl)prop-2-enoate (CAS 3082545-22-7) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: methyl (E)-3-(3-amino-6-chloro-2-pyridinyl)prop-2-enoate. InChIKey: PCBADBMBHWGLLR-HWKANZROSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | methyl (E)-3-(3-amino-6-chloro-2-pyridinyl)prop-2-enoate |
| InChIKey | PCBADBMBHWGLLR-HWKANZROSA-N |
| SMILES | COC(=O)/C=C/C1=C(C=CC(=N1)Cl)N |
Computed by PubChem (NCBI)