Products 30902-36-4
CAS 30902-36-4 appears in our catalog under these names: Cytarabine Impurity 24, Cytarabine Impurity 9, Cytarabine Impurity 13, Cytarabine-N-Oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-hydroxy-4-iminopyrimidin-2-one (CAS 30902-36-4) is a chemical compound with the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. IUPAC name: 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-hydroxy-4-iminopyrimidin-2-one. InChIKey: LTZXOJFEMCDRAF-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O6 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-hydroxy-4-iminopyrimidin-2-one |
| InChIKey | LTZXOJFEMCDRAF-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)N(C1=N)O)C2C(C(C(O2)CO)O)O |
Computed by PubChem (NCBI)