CAS 38934-69-9 appears in our catalog under these names: 1-b-D-Ribofuranosyl-1,2,4-triazole-3-carboxylic Acid Methyl Ester(Ribavirin Impurity H), 1-Beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxylic Acid Methyl Ester (Ribavirin Impurity H), 1-b-D-Ribofuranosyl-1,2,4-triazole-3-carboxylic acid methyl ester, Methyl 1-β-D-ribofuranosyl-1H-1,2,4-triazole-3-carboxylate. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 2mg, 100 mg, 10 mg.
Methyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxylate (CAS 38934-69-9) is a chemical compound with the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. IUPAC name: methyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxylate. InChIKey: RFJYLFZDYHCYNF-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O6 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | methyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxylate |
| InChIKey | RFJYLFZDYHCYNF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C=N1)C2C(C(C(O2)CO)O)O |
Computed by PubChem (NCBI)