CAS 402725-23-9 is the registry number for Molnupiravir Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (CAS 402725-23-9) is a chemical compound with the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. IUPAC name: 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one. InChIKey: XCUAIINAJCDIPM-PSQAKQOGSA-N.
| Molecular formula | C9H13N3O6 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| InChIKey | XCUAIINAJCDIPM-PSQAKQOGSA-N |
| SMILES | C1=CN(C(=O)N=C1NO)[C@@H]2[C@H]([C@H]([C@@H](O2)CO)O)O |
Computed by PubChem (NCBI)