CAS 58461-29-3 is the registry number for Cytarabine Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidin-2-one (CAS 58461-29-3) is a chemical compound with the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. IUPAC name: 4-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidin-2-one. InChIKey: MPPUDRFYDKDPBN-CAXIXURWSA-N.
| Molecular formula | C9H13N3O6 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 4-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidin-2-one |
| InChIKey | MPPUDRFYDKDPBN-CAXIXURWSA-N |
| SMILES | C1=C(C(=NC(=O)N1[C@H]2C([C@H]([C@H](O2)CO)O)O)N)O |
Computed by PubChem (NCBI)