CAS 309737-83-5 appears in our catalog under these names: 1-(2-Bromophenyl)-1H-1,2,3,4-tetrazole, 1-(2-bromophenyl)-1H-1,2,3,4-tetrazole, ≥95%, ≥95%, 1-(2-Bromophenyl)-1H-1,2,3,4-tetrazole, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
1-(2-bromophenyl)tetrazole (CAS 309737-83-5) is a chemical compound with the molecular formula C7H5BrN4 and a molecular weight of 225.05 g/mol. IUPAC name: 1-(2-bromophenyl)tetrazole. InChIKey: JIIHTZCRHRSTDL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4 |
|---|---|
| Molecular weight | 225.05 g/mol |
| IUPAC name | 1-(2-bromophenyl)tetrazole |
| InChIKey | JIIHTZCRHRSTDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=NN=N2)Br |
Computed by PubChem (NCBI)