CAS 31009-03-7 appears in our catalog under these names: 7–Fluoroquinoline–4–carboxylic acid, 7-Fluoroquinoline-4-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 10g.
7-fluoroquinoline-4-carboxylic acid (CAS 31009-03-7) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 7-fluoroquinoline-4-carboxylic acid. InChIKey: QIRLJMJLJXBUMP-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 7-fluoroquinoline-4-carboxylic acid |
| InChIKey | QIRLJMJLJXBUMP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1F)C(=O)O |
Computed by PubChem (NCBI)