CAS 31052-93-4 appears in our catalog under these names: 2-Phenyl-(1,2,4)triazolo(1,5-a)pyridin-6-amine, 97%, 2-Phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine, >95.0%(qNMR), 2-Phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine, 97%, 97%, 2-PHENYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-AMINE, 97%. Offered by: AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (CAS 31052-93-4) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine. InChIKey: GJDPUDWEEVLQBH-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| InChIKey | GJDPUDWEEVLQBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C=C(C=CC3=N2)N |
Computed by PubChem (NCBI)