Products 3110247-62-3
CAS 3110247-62-3 is the registry number for 2-(tert-Butyl)-5H-benzofuro[3,2-c]carbazole, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-tert-butyl-5H-[1]benzofuro[3,2-c]carbazole (CAS 3110247-62-3) is a chemical compound with the molecular formula C22H19NO and a molecular weight of 313.4 g/mol. IUPAC name: 2-tert-butyl-5H-[1]benzofuro[3,2-c]carbazole. InChIKey: RZOZHEBFBBRRMW-UHFFFAOYSA-N.
| Molecular formula | C22H19NO |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 2-tert-butyl-5H-[1]benzofuro[3,2-c]carbazole |
| InChIKey | RZOZHEBFBBRRMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC3=C2C4=C(C=C3)C5=CC=CC=C5O4 |
Computed by PubChem (NCBI)