Products 312538-62-8

CAS 312538-62-8 is the registry number for Ethambutol Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-[2-[[(1S)-1-carboxypropyl]amino]ethylamino]butanoic acid (CAS 312538-62-8) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: (2S)-2-[2-[[(1S)-1-carboxypropyl]amino]ethylamino]butanoic acid. InChIKey: LLOPSLUNSGBASE-YUMQZZPRSA-N.

Identity
Molecular formulaC10H20N2O4
Molecular weight232.28 g/mol
IUPAC name(2S)-2-[2-[[(1S)-1-carboxypropyl]amino]ethylamino]butanoic acid
InChIKeyLLOPSLUNSGBASE-YUMQZZPRSA-N
SMILESCC[C@@H](C(=O)O)NCCN[C@@H](CC)C(=O)O

Computed by PubChem (NCBI)