CAS 31255-47-7 appears in our catalog under these names: Loratadine Impurity 33, 3-(3-chlorophenethyl)pyridine 1-oxide, Desloratadine Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-(3-chlorophenyl)ethyl]-1-oxidopyridin-1-ium (CAS 31255-47-7) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 3-[2-(3-chlorophenyl)ethyl]-1-oxidopyridin-1-ium. InChIKey: ZELCJWGXNLFDPT-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-[2-(3-chlorophenyl)ethyl]-1-oxidopyridin-1-ium |
| InChIKey | ZELCJWGXNLFDPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCC2=C[N+](=CC=C2)[O-] |
Computed by PubChem (NCBI)