Products 312607-68-4
CAS 312607-68-4 appears in our catalog under these names: WAY-301398, WAY–301398, WAY-301398, 95.0%, 1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione, 95%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 2mg, 10mg, 100mg, 5mg, 50mg, 100 mg, 50 mg, 10 mg.
1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione (CAS 312607-68-4) is a chemical compound with the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione. InChIKey: ABKONMXONQQXKA-UHFFFAOYSA-N.
| Molecular formula | C16H13FO4 |
|---|---|
| Molecular weight | 288.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione |
| InChIKey | ABKONMXONQQXKA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)C(=O)CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)