Products 31271-83-7
CAS 31271-83-7 appears in our catalog under these names: 4,7-Dimethoxy-1H-indole-2-carboxylic acid, 97%, 4,7-DIMETHOXY-1H-INDOLE-2-CARBOXYLIC ACID, 95%, 95%, 4,7-Dimethoxy-1H-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 50mg, 250mg, 500mg.
4,7-dimethoxy-1H-indole-2-carboxylic acid (CAS 31271-83-7) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4,7-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: FJWNGDWJFIQNEG-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4,7-dimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | FJWNGDWJFIQNEG-UHFFFAOYSA-N |
| SMILES | COC1=C2C=C(NC2=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)